About 3-isocyanatopentan-2-yl prop-2-enoate
3-isocyanatopentan-2-yl prop-2-enoate (PubChem CID 57103280) has the molecular formula C9H13NO3
and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-isocyanatopentan-2-yl prop-2-enoate.
Molecular Properties
| Compound Name | 3-isocyanatopentan-2-yl prop-2-enoate |
| PubChem CID | 57103280 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 3-isocyanatopentan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)C(CC)N=C=O |
| InChI | InChI=1S/C9H13NO3/c1-4-8(10-6-11)7(3)13-9(12)5-2/h5,7-8H,2,4H2,1,3H3 |
| InChIKey | GWBAYHNQEJBONM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-isocyanatopentan-2-yl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-isocyanatopentan-2-yl prop-2-enoate?
The IUPAC name of 3-isocyanatopentan-2-yl prop-2-enoate (CID 57103280) is 3-isocyanatopentan-2-yl prop-2-enoate.
What is the SMILES notation for 3-isocyanatopentan-2-yl prop-2-enoate?
The canonical SMILES for 3-isocyanatopentan-2-yl prop-2-enoate is C=CC(=O)OC(C)C(CC)N=C=O.
What is the InChIKey of 3-isocyanatopentan-2-yl prop-2-enoate?
The InChIKey is GWBAYHNQEJBONM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO3/c1-4-8(10-6-11)7(3)13-9(12)5-2/h5,7-8H,2,4H2,1,3H3.
What are the key properties of 3-isocyanatopentan-2-yl prop-2-enoate?
3-isocyanatopentan-2-yl prop-2-enoate has a molecular weight of 183.21 g/mol, XLogP of 1.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-isocyanatopentan-2-yl prop-2-enoate is sourced from PubChem (CID 57103280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).