C9H13NO3 — CID 150862263
(2-isocyanato-3-methylbutyl) prop-2-enoate (PubChem CID 150862263) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (2-isocyanato-3-methylbutyl) prop-2-enoate.
| Compound Name | (2-isocyanato-3-methylbutyl) prop-2-enoate |
|---|---|
| PubChem CID | 150862263 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (2-isocyanato-3-methylbutyl) prop-2-enoate |
| SMILES | C=CC(=O)OCC(N=C=O)C(C)C |
| InChI | InChI=1S/C9H13NO3/c1-4-9(12)13-5-8(7(2)3)10-6-11/h4,7-8H,1,5H2,2-3H3 |
| InChIKey | KSHFECQPFRAGSG-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|