About 2-isocyanatoheptyl prop-2-enoate
2-isocyanatoheptyl prop-2-enoate (PubChem CID 137478345) has the molecular formula C11H17NO3
and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-isocyanatoheptyl prop-2-enoate.
Molecular Properties
| Compound Name | 2-isocyanatoheptyl prop-2-enoate |
| PubChem CID | 137478345 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-isocyanatoheptyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(CCCCC)N=C=O |
| InChI | InChI=1S/C11H17NO3/c1-3-5-6-7-10(12-9-13)8-15-11(14)4-2/h4,10H,2-3,5-8H2,1H3 |
| InChIKey | KYQRAUWTRXADAA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanatoheptyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanatoheptyl prop-2-enoate?
The IUPAC name of 2-isocyanatoheptyl prop-2-enoate (CID 137478345) is 2-isocyanatoheptyl prop-2-enoate.
What is the SMILES notation for 2-isocyanatoheptyl prop-2-enoate?
The canonical SMILES for 2-isocyanatoheptyl prop-2-enoate is C=CC(=O)OCC(CCCCC)N=C=O.
What is the InChIKey of 2-isocyanatoheptyl prop-2-enoate?
The InChIKey is KYQRAUWTRXADAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3/c1-3-5-6-7-10(12-9-13)8-15-11(14)4-2/h4,10H,2-3,5-8H2,1H3.
What are the key properties of 2-isocyanatoheptyl prop-2-enoate?
2-isocyanatoheptyl prop-2-enoate has a molecular weight of 211.26 g/mol, XLogP of 2.00, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanatoheptyl prop-2-enoate is sourced from PubChem (CID 137478345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).