About prop-2-enyl 2-isocyanatohexanoate
prop-2-enyl 2-isocyanatohexanoate (PubChem CID 22163533) has the molecular formula C10H15NO3
and a molecular weight of 197.23 g/mol. Its IUPAC name is prop-2-enyl 2-isocyanatohexanoate.
Molecular Properties
| Compound Name | prop-2-enyl 2-isocyanatohexanoate |
| PubChem CID | 22163533 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | prop-2-enyl 2-isocyanatohexanoate |
| SMILES | C=CCOC(=O)C(CCCC)N=C=O |
| InChI | InChI=1S/C10H15NO3/c1-3-5-6-9(11-8-12)10(13)14-7-4-2/h4,9H,2-3,5-7H2,1H3 |
| InChIKey | ORZBUOAWEVZKIK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 2-isocyanatohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 2-isocyanatohexanoate?
The IUPAC name of prop-2-enyl 2-isocyanatohexanoate (CID 22163533) is prop-2-enyl 2-isocyanatohexanoate.
What is the SMILES notation for prop-2-enyl 2-isocyanatohexanoate?
The canonical SMILES for prop-2-enyl 2-isocyanatohexanoate is C=CCOC(=O)C(CCCC)N=C=O.
What is the InChIKey of prop-2-enyl 2-isocyanatohexanoate?
The InChIKey is ORZBUOAWEVZKIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO3/c1-3-5-6-9(11-8-12)10(13)14-7-4-2/h4,9H,2-3,5-7H2,1H3.
What are the key properties of prop-2-enyl 2-isocyanatohexanoate?
prop-2-enyl 2-isocyanatohexanoate has a molecular weight of 197.23 g/mol, XLogP of 1.61, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 2-isocyanatohexanoate is sourced from PubChem (CID 22163533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).