About bis(prop-2-enyl) 2-heptylpropanedioate
bis(prop-2-enyl) 2-heptylpropanedioate (PubChem CID 21304231) has the molecular formula C16H26O4
and a molecular weight of 282.38 g/mol. Its IUPAC name is bis(prop-2-enyl) 2-heptylpropanedioate.
Molecular Properties
| Compound Name | bis(prop-2-enyl) 2-heptylpropanedioate |
| PubChem CID | 21304231 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | bis(prop-2-enyl) 2-heptylpropanedioate |
| SMILES | C=CCOC(=O)C(CCCCCCC)C(=O)OCC=C |
| InChI | InChI=1S/C16H26O4/c1-4-7-8-9-10-11-14(15(17)19-12-5-2)16(18)20-13-6-3/h5-6,14H,2-4,7-13H2,1H3 |
| InChIKey | XZSNRZPHNLNSAB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis(prop-2-enyl) 2-heptylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(prop-2-enyl) 2-heptylpropanedioate?
The IUPAC name of bis(prop-2-enyl) 2-heptylpropanedioate (CID 21304231) is bis(prop-2-enyl) 2-heptylpropanedioate.
What is the SMILES notation for bis(prop-2-enyl) 2-heptylpropanedioate?
The canonical SMILES for bis(prop-2-enyl) 2-heptylpropanedioate is C=CCOC(=O)C(CCCCCCC)C(=O)OCC=C.
What is the InChIKey of bis(prop-2-enyl) 2-heptylpropanedioate?
The InChIKey is XZSNRZPHNLNSAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O4/c1-4-7-8-9-10-11-14(15(17)19-12-5-2)16(18)20-13-6-3/h5-6,14H,2-4,7-13H2,1H3.
What are the key properties of bis(prop-2-enyl) 2-heptylpropanedioate?
bis(prop-2-enyl) 2-heptylpropanedioate has a molecular weight of 282.38 g/mol, XLogP of 3.42, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(prop-2-enyl) 2-heptylpropanedioate is sourced from PubChem (CID 21304231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).