About 1-O-ethyl 3-O-prop-2-enyl 2-ethylpropanedioate
1-O-ethyl 3-O-prop-2-enyl 2-ethylpropanedioate (PubChem CID 57172594) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 1-O-ethyl 3-O-prop-2-enyl 2-ethylpropanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 3-O-prop-2-enyl 2-ethylpropanedioate |
| PubChem CID | 57172594 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1-O-ethyl 3-O-prop-2-enyl 2-ethylpropanedioate |
| SMILES | C=CCOC(=O)C(CC)C(=O)OCC |
| InChI | InChI=1S/C10H16O4/c1-4-7-14-10(12)8(5-2)9(11)13-6-3/h4,8H,1,5-7H2,2-3H3 |
| InChIKey | RWSVZDCZEZCFRM-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 3-O-prop-2-enyl 2-ethylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 3-O-prop-2-enyl 2-ethylpropanedioate?
The IUPAC name of 1-O-ethyl 3-O-prop-2-enyl 2-ethylpropanedioate (CID 57172594) is 1-O-ethyl 3-O-prop-2-enyl 2-ethylpropanedioate.
What is the SMILES notation for 1-O-ethyl 3-O-prop-2-enyl 2-ethylpropanedioate?
The canonical SMILES for 1-O-ethyl 3-O-prop-2-enyl 2-ethylpropanedioate is C=CCOC(=O)C(CC)C(=O)OCC.
What is the InChIKey of 1-O-ethyl 3-O-prop-2-enyl 2-ethylpropanedioate?
The InChIKey is RWSVZDCZEZCFRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-4-7-14-10(12)8(5-2)9(11)13-6-3/h4,8H,1,5-7H2,2-3H3.
What are the key properties of 1-O-ethyl 3-O-prop-2-enyl 2-ethylpropanedioate?
1-O-ethyl 3-O-prop-2-enyl 2-ethylpropanedioate has a molecular weight of 200.23 g/mol, XLogP of 1.30, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 3-O-prop-2-enyl 2-ethylpropanedioate is sourced from PubChem (CID 57172594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).