C18H36O5Si4 — CID 87532765
1-tris[[ethenyl(dimethyl)silyl]oxy]silylpropyl prop-2-enoate (PubChem CID 87532765) has the molecular formula C18H36O5Si4 and a molecular weight of 444.83 g/mol. Its IUPAC name is 1-tris[[ethenyl(dimethyl)silyl]oxy]silylpropyl prop-2-enoate.
| Compound Name | 1-tris[[ethenyl(dimethyl)silyl]oxy]silylpropyl prop-2-enoate |
|---|---|
| PubChem CID | 87532765 |
| Molecular Formula | C18H36O5Si4 |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 1-tris[[ethenyl(dimethyl)silyl]oxy]silylpropyl prop-2-enoate |
| SMILES | C=CC(=O)OC(CC)[Si](O[Si](C)(C)C=C)(O[Si](C)(C)C=C)O[Si](C)(C)C=C |
| InChI | InChI=1S/C18H36O5Si4/c1-12-17(19)20-18(13-2)27(21-24(6,7)14-3,22-25(8,9)15-4)23-26(10,11)16-5/h12,14-16,18H,1,3-5,13H2,2,6-11H3 |
| InChIKey | AIHZLYUUFKFHCJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|