C22H56O5Si7 — CID 176899209
1-tris[[dimethyl(trimethylsilyl)silyl]oxy]silylpropyl (E)-but-2-enoate (PubChem CID 176899209) has the molecular formula C22H56O5Si7 and a molecular weight of 597.29 g/mol. Its IUPAC name is 1-tris[[dimethyl(trimethylsilyl)silyl]oxy]silylpropyl (E)-but-2-enoate.
| Compound Name | 1-tris[[dimethyl(trimethylsilyl)silyl]oxy]silylpropyl (E)-but-2-enoate |
|---|---|
| PubChem CID | 176899209 |
| Molecular Formula | C22H56O5Si7 |
| Molecular Weight | 597.29 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | 1-tris[[dimethyl(trimethylsilyl)silyl]oxy]silylpropyl (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OC(CC)[Si](O[Si](C)(C)[Si](C)(C)C)(O[Si](C)(C)[Si](C)(C)C)O[Si](C)(C)[Si](C)(C)C |
| InChI | InChI=1S/C22H56O5Si7/c1-18-20-21(23)24-22(19-2)34(25-31(12,13)28(3,4)5,26-32(14,15)29(6,7)8)27-33(16,17)30(9,10)11/h18,20,22H,19H2,1-17H3/b20-18+ |
| InChIKey | NFLFZAROYDDTOA-CZIZESTLSA-N |
| XLogP | 7.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.29 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|