C21H38F8O7Si4 — CID 173346817
4-O-(1,2,2,3,3,4,5,5-octafluoropentyl) 1-O-[1-tris(trimethylsilyloxy)silylpropyl] but-2-enedioate (PubChem CID 173346817) has the molecular formula C21H38F8O7Si4 and a molecular weight of 666.86 g/mol. Its IUPAC name is 4-O-(1,2,2,3,3,4,5,5-octafluoropentyl) 1-O-[1-tris(trimethylsilyloxy)silylpropyl] but-2-enedioate.
| Compound Name | 4-O-(1,2,2,3,3,4,5,5-octafluoropentyl) 1-O-[1-tris(trimethylsilyloxy)silylpropyl] but-2-enedioate |
|---|---|
| PubChem CID | 173346817 |
| Molecular Formula | C21H38F8O7Si4 |
| Molecular Weight | 666.86 g/mol |
| Exact Mass | 666.16 |
| IUPAC Name | 4-O-(1,2,2,3,3,4,5,5-octafluoropentyl) 1-O-[1-tris(trimethylsilyloxy)silylpropyl] but-2-enedioate |
| SMILES | CCC(OC(=O)C=CC(=O)OC(F)C(F)(F)C(F)(F)C(F)C(F)F)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C21H38F8O7Si4/c1-11-16(40(34-37(2,3)4,35-38(5,6)7)36-39(8,9)10)32-14(30)12-13-15(31)33-19(25)21(28,29)20(26,27)17(22)18(23)24/h12-13,16-19H,11H2,1-10H3 |
| InChIKey | QNUBVYJSGKBUCU-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.86 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|