C17H34O6Si2 — CID 173346870
1-O-[2-[dimethyl(trimethylsilyloxy)silyl]-2-propoxyethyl] 4-O-propan-2-yl but-2-enedioate (PubChem CID 173346870) has the molecular formula C17H34O6Si2 and a molecular weight of 390.63 g/mol. Its IUPAC name is 1-O-[2-[dimethyl(trimethylsilyloxy)silyl]-2-propoxyethyl] 4-O-propan-2-yl but-2-enedioate.
| Compound Name | 1-O-[2-[dimethyl(trimethylsilyloxy)silyl]-2-propoxyethyl] 4-O-propan-2-yl but-2-enedioate |
|---|---|
| PubChem CID | 173346870 |
| Molecular Formula | C17H34O6Si2 |
| Molecular Weight | 390.63 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-O-[2-[dimethyl(trimethylsilyloxy)silyl]-2-propoxyethyl] 4-O-propan-2-yl but-2-enedioate |
| SMILES | CCCOC(COC(=O)C=CC(=O)OC(C)C)[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H34O6Si2/c1-9-12-20-17(25(7,8)23-24(4,5)6)13-21-15(18)10-11-16(19)22-14(2)3/h10-11,14,17H,9,12-13H2,1-8H3 |
| InChIKey | FVOWWMMKLMUGQT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.63 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|