C13H21NO5 — CID 126492299
1-O-[(2S)-2-(propanoylamino)propyl] 4-O-propan-2-yl (E)-but-2-enedioate (PubChem CID 126492299) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is 1-O-[(2S)-2-(propanoylamino)propyl] 4-O-propan-2-yl (E)-but-2-enedioate.
| Compound Name | 1-O-[(2S)-2-(propanoylamino)propyl] 4-O-propan-2-yl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126492299 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-O-[(2S)-2-(propanoylamino)propyl] 4-O-propan-2-yl (E)-but-2-enedioate |
| SMILES | CCC(=O)N[C@@H](C)COC(=O)/C=C/C(=O)OC(C)C |
| InChI | InChI=1S/C13H21NO5/c1-5-11(15)14-10(4)8-18-12(16)6-7-13(17)19-9(2)3/h6-7,9-10H,5,8H2,1-4H3,(H,14,15)/b7-6+/t10-/m0/s1 |
| InChIKey | KBEBJYPMZSFJRK-FGEFZZPRSA-N |
| XLogP | 0.95 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|