C16H21NO6S — CID 126491717
1-O-[2-(benzenesulfonamido)propyl] 4-O-propan-2-yl (E)-but-2-enedioate (PubChem CID 126491717) has the molecular formula C16H21NO6S and a molecular weight of 355.41 g/mol. Its IUPAC name is 1-O-[2-(benzenesulfonamido)propyl] 4-O-propan-2-yl (E)-but-2-enedioate.
| Compound Name | 1-O-[2-(benzenesulfonamido)propyl] 4-O-propan-2-yl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126491717 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-O-[2-(benzenesulfonamido)propyl] 4-O-propan-2-yl (E)-but-2-enedioate |
| SMILES | CC(COC(=O)/C=C/C(=O)OC(C)C)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H21NO6S/c1-12(2)23-16(19)10-9-15(18)22-11-13(3)17-24(20,21)14-7-5-4-6-8-14/h4-10,12-13,17H,11H2,1-3H3/b10-9+ |
| InChIKey | OMCLQFGNOANGAM-MDZDMXLPSA-N |
| XLogP | 1.40 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|