C19H45NO6Si4 — CID 87342818
1-tris(trimethylsilyloxy)silylpropyl N-ethyl-N-(2-methylprop-2-enoxy)carbamate (PubChem CID 87342818) has the molecular formula C19H45NO6Si4 and a molecular weight of 495.91 g/mol. Its IUPAC name is 1-tris(trimethylsilyloxy)silylpropyl N-ethyl-N-(2-methylprop-2-enoxy)carbamate.
| Compound Name | 1-tris(trimethylsilyloxy)silylpropyl N-ethyl-N-(2-methylprop-2-enoxy)carbamate |
|---|---|
| PubChem CID | 87342818 |
| Molecular Formula | C19H45NO6Si4 |
| Molecular Weight | 495.91 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 1-tris(trimethylsilyloxy)silylpropyl N-ethyl-N-(2-methylprop-2-enoxy)carbamate |
| SMILES | C=C(C)CON(CC)C(=O)OC(CC)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H45NO6Si4/c1-14-18(23-19(21)20(15-2)22-16-17(3)4)30(24-27(5,6)7,25-28(8,9)10)26-29(11,12)13/h18H,3,14-16H2,1-2,4-13H3 |
| InChIKey | FNDKQQHMAOBCKF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.91 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|