C28H51N3O7Si4 — CID 87356592
2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione;1-tris(trimethylsilyloxy)silylpropyl 2-methylprop-2-enoate (PubChem CID 87356592) has the molecular formula C28H51N3O7Si4 and a molecular weight of 654.07 g/mol. Its IUPAC name is 2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione;1-tris(trimethylsilyloxy)silylpropyl 2-methylprop-2-enoate.
| Compound Name | 2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione;1-tris(trimethylsilyloxy)silylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87356592 |
| Molecular Formula | C28H51N3O7Si4 |
| Molecular Weight | 654.07 g/mol |
| Exact Mass | 653.28 |
| IUPAC Name | 2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione;1-tris(trimethylsilyloxy)silylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C.O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1 |
| InChI | InChI=1S/C16H38O5Si4.C12H13N3O2/c1-13-15(18-16(17)14(2)3)25(19-22(4,5)6,20-23(7,8)9)21-24(10,11)12;16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14/h15H,2,13H2,1,3-12H3;7H,1-6H2 |
| InChIKey | IAQVDQBSHKTJJU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 97.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.07 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|