C20H29CrN3O4 — CID 88682877
chromium;octanoic acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 88682877) has the molecular formula C20H29CrN3O4 and a molecular weight of 427.47 g/mol. Its IUPAC name is chromium;octanoic acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | chromium;octanoic acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 88682877 |
| Molecular Formula | C20H29CrN3O4 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | chromium;octanoic acid;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCCCCCC(=O)O.O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1.[Cr] |
| InChI | InChI=1S/C12H13N3O2.C8H16O2.Cr/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14;1-2-3-4-5-6-7-8(9)10;/h7H,1-6H2;2-7H2,1H3,(H,9,10); |
| InChIKey | BQAJBTURTQQFNE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|