C25H46O10 — CID 161134683
decanoic acid;hexanedioic acid;nonanedioic acid (PubChem CID 161134683) has the molecular formula C25H46O10 and a molecular weight of 506.63 g/mol. Its IUPAC name is decanoic acid;hexanedioic acid;nonanedioic acid.
| Compound Name | decanoic acid;hexanedioic acid;nonanedioic acid |
|---|---|
| PubChem CID | 161134683 |
| Molecular Formula | C25H46O10 |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 506.31 |
| IUPAC Name | decanoic acid;hexanedioic acid;nonanedioic acid |
| SMILES | CCCCCCCCCC(=O)O.O=C(O)CCCCC(=O)O.O=C(O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C10H20O2.C9H16O4.C6H10O4/c1-2-3-4-5-6-7-8-9-10(11)12;10-8(11)6-4-2-1-3-5-7-9(12)13;7-5(8)3-1-2-4-6(9)10/h2-9H2,1H3,(H,11,12);1-7H2,(H,10,11)(H,12,13);1-4H2,(H,7,8)(H,9,10) |
| InChIKey | UMQDUPZWWKEARK-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|