About bis(hexane);tetradecanoic acid
bis(hexane);tetradecanoic acid (PubChem CID 173301731) has the molecular formula C26H56O2
and a molecular weight of 400.73 g/mol. Its IUPAC name is bis(hexane);tetradecanoic acid.
Molecular Properties
| Compound Name | bis(hexane);tetradecanoic acid |
| PubChem CID | 173301731 |
| Molecular Formula | C26H56O2 |
| Molecular Weight | 400.73 g/mol |
| Exact Mass | 400.43 |
| IUPAC Name | bis(hexane);tetradecanoic acid |
| SMILES | CCCCCC.CCCCCC.CCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C14H28O2.2C6H14/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;2*1-3-5-6-4-2/h2-13H2,1H3,(H,15,16);2*3-6H2,1-2H3 |
| InChIKey | CXTWJBSQRAOACL-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.73 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(hexane);tetradecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(hexane);tetradecanoic acid?
The IUPAC name of bis(hexane);tetradecanoic acid (CID 173301731) is bis(hexane);tetradecanoic acid.
What is the SMILES notation for bis(hexane);tetradecanoic acid?
The canonical SMILES for bis(hexane);tetradecanoic acid is CCCCCC.CCCCCC.CCCCCCCCCCCCCC(=O)O.
What is the InChIKey of bis(hexane);tetradecanoic acid?
The InChIKey is CXTWJBSQRAOACL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2.2C6H14/c1-2-3-4-5-6-7-8-9-10-11-12-13-14(15)16;2*1-3-5-6-4-2/h2-13H2,1H3,(H,15,16);2*3-6H2,1-2H3.
What are the key properties of bis(hexane);tetradecanoic acid?
bis(hexane);tetradecanoic acid has a molecular weight of 400.73 g/mol, XLogP of 9.95, 18 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(hexane);tetradecanoic acid is sourced from PubChem (CID 173301731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).