C24H56N2O9Si4 — CID 67766613
2-amino-2-(hydroxymethyl)propane-1,3-diol;pyrrolidin-2-one;1-tris(trimethylsilyloxy)silylpropyl 2-methylprop-2-enoate (PubChem CID 67766613) has the molecular formula C24H56N2O9Si4 and a molecular weight of 629.06 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;pyrrolidin-2-one;1-tris(trimethylsilyloxy)silylpropyl 2-methylprop-2-enoate.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;pyrrolidin-2-one;1-tris(trimethylsilyloxy)silylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67766613 |
| Molecular Formula | C24H56N2O9Si4 |
| Molecular Weight | 629.06 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;pyrrolidin-2-one;1-tris(trimethylsilyloxy)silylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C.NC(CO)(CO)CO.O=C1CCCN1 |
| InChI | InChI=1S/C16H38O5Si4.C4H11NO3.C4H7NO/c1-13-15(18-16(17)14(2)3)25(19-22(4,5)6,20-23(7,8)9)21-24(10,11)12;5-4(1-6,2-7)3-8;6-4-2-1-3-5-4/h15H,2,13H2,1,3-12H3;6-8H,1-3,5H2;1-3H2,(H,5,6) |
| InChIKey | LGMWORQUUIUANT-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 169.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.06 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|