C11H15F6NO3 — CID 159858111
1,1,1,3,3,3-hexafluoropropane;2-methylprop-2-enoic acid;pyrrolidin-2-one (PubChem CID 159858111) has the molecular formula C11H15F6NO3 and a molecular weight of 323.23 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropane;2-methylprop-2-enoic acid;pyrrolidin-2-one.
| Compound Name | 1,1,1,3,3,3-hexafluoropropane;2-methylprop-2-enoic acid;pyrrolidin-2-one |
|---|---|
| PubChem CID | 159858111 |
| Molecular Formula | C11H15F6NO3 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropane;2-methylprop-2-enoic acid;pyrrolidin-2-one |
| SMILES | C=C(C)C(=O)O.FC(F)(F)CC(F)(F)F.O=C1CCCN1 |
| InChI | InChI=1S/C4H7NO.C4H6O2.C3H2F6/c6-4-2-1-3-5-4;1-3(2)4(5)6;4-2(5,6)1-3(7,8)9/h1-3H2,(H,5,6);1H2,2H3,(H,5,6);1H2 |
| InChIKey | NQUDMPDGCAURPB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|