C19H44O7Si4 — CID 22134039
[2-hydroxy-3-[1-tris(trimethylsilyloxy)silylpropoxy]propyl] 2-methylprop-2-enoate (PubChem CID 22134039) has the molecular formula C19H44O7Si4 and a molecular weight of 496.90 g/mol. Its IUPAC name is [2-hydroxy-3-[1-tris(trimethylsilyloxy)silylpropoxy]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-[1-tris(trimethylsilyloxy)silylpropoxy]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22134039 |
| Molecular Formula | C19H44O7Si4 |
| Molecular Weight | 496.90 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | [2-hydroxy-3-[1-tris(trimethylsilyloxy)silylpropoxy]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(CC)[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H44O7Si4/c1-13-18(22-14-17(20)15-23-19(21)16(2)3)30(24-27(4,5)6,25-28(7,8)9)26-29(10,11)12/h17-18,20H,2,13-15H2,1,3-12H3 |
| InChIKey | LUFQWRNXEIBHTJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.90 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|