C17H38O5Si3 — CID 160516479
[2-hydroxy-4-[propyl-bis(trimethylsilyloxy)silyl]butyl] 2-methylprop-2-enoate (PubChem CID 160516479) has the molecular formula C17H38O5Si3 and a molecular weight of 406.74 g/mol. Its IUPAC name is [2-hydroxy-4-[propyl-bis(trimethylsilyloxy)silyl]butyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-4-[propyl-bis(trimethylsilyloxy)silyl]butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 160516479 |
| Molecular Formula | C17H38O5Si3 |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [2-hydroxy-4-[propyl-bis(trimethylsilyloxy)silyl]butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CC[Si](CCC)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H38O5Si3/c1-10-12-25(21-23(4,5)6,22-24(7,8)9)13-11-16(18)14-20-17(19)15(2)3/h16,18H,2,10-14H2,1,3-9H3 |
| InChIKey | QTSLLKUJBRQNCP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|