C18H34O7Si2 — CID 140749715
[2-hydroxy-3-[3-[methyl-(2-methylprop-2-enoyloxy)-trimethylsilyloxysilyl]propoxy]propyl] 2-methylprop-2-enoate (PubChem CID 140749715) has the molecular formula C18H34O7Si2 and a molecular weight of 418.64 g/mol. Its IUPAC name is [2-hydroxy-3-[3-[methyl-(2-methylprop-2-enoyloxy)-trimethylsilyloxysilyl]propoxy]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-[3-[methyl-(2-methylprop-2-enoyloxy)-trimethylsilyloxysilyl]propoxy]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140749715 |
| Molecular Formula | C18H34O7Si2 |
| Molecular Weight | 418.64 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | [2-hydroxy-3-[3-[methyl-(2-methylprop-2-enoyloxy)-trimethylsilyloxysilyl]propoxy]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COCCC[Si](C)(OC(=O)C(=C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H34O7Si2/c1-14(2)17(20)23-13-16(19)12-22-10-9-11-27(8,25-26(5,6)7)24-18(21)15(3)4/h16,19H,1,3,9-13H2,2,4-8H3 |
| InChIKey | KJMQWYOTIWGYIO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.64 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|