C18H41NO5Si3 — CID 140853527
N-[3-hydroxy-4-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]butyl]-2-methylprop-2-enamide (PubChem CID 140853527) has the molecular formula C18H41NO5Si3 and a molecular weight of 435.79 g/mol. Its IUPAC name is N-[3-hydroxy-4-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]butyl]-2-methylprop-2-enamide.
| Compound Name | N-[3-hydroxy-4-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]butyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 140853527 |
| Molecular Formula | C18H41NO5Si3 |
| Molecular Weight | 435.79 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[3-hydroxy-4-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]butyl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NCCC(O)COCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H41NO5Si3/c1-16(2)18(21)19-12-11-17(20)15-22-13-10-14-27(9,23-25(3,4)5)24-26(6,7)8/h17,20H,1,10-15H2,2-9H3,(H,19,21) |
| InChIKey | OAWGWAKDMJUOIN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.79 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|