C22H44O6Si3 — CID 140891427
[1-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]-3-(3-methylbuta-1,3-dien-2-yloxy)propan-2-yl] 2-methylprop-2-enoate (PubChem CID 140891427) has the molecular formula C22H44O6Si3 and a molecular weight of 488.85 g/mol. Its IUPAC name is [1-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]-3-(3-methylbuta-1,3-dien-2-yloxy)propan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]-3-(3-methylbuta-1,3-dien-2-yloxy)propan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140891427 |
| Molecular Formula | C22H44O6Si3 |
| Molecular Weight | 488.85 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | [1-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]-3-(3-methylbuta-1,3-dien-2-yloxy)propan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=C)OCC(COCCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)OC(=O)C(=C)C |
| InChI | InChI=1S/C22H44O6Si3/c1-18(2)20(5)25-17-21(26-22(23)19(3)4)16-24-14-13-15-31(12,27-29(6,7)8)28-30(9,10)11/h21H,1,3,5,13-17H2,2,4,6-12H3 |
| InChIKey | WLMXUMQWUGDOLH-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.85 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|