C19H42O7Si3 — CID 87152295
[2-[3-(2-hydroxyethoxy)propoxy]-3-[methyl-bis(trimethylsilyloxy)silyl]propyl] 2-methylprop-2-enoate (PubChem CID 87152295) has the molecular formula C19H42O7Si3 and a molecular weight of 466.80 g/mol. Its IUPAC name is [2-[3-(2-hydroxyethoxy)propoxy]-3-[methyl-bis(trimethylsilyloxy)silyl]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-[3-(2-hydroxyethoxy)propoxy]-3-[methyl-bis(trimethylsilyloxy)silyl]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87152295 |
| Molecular Formula | C19H42O7Si3 |
| Molecular Weight | 466.80 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | [2-[3-(2-hydroxyethoxy)propoxy]-3-[methyl-bis(trimethylsilyloxy)silyl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C)OCCCOCCO |
| InChI | InChI=1S/C19H42O7Si3/c1-17(2)19(21)24-15-18(23-13-10-12-22-14-11-20)16-29(9,25-27(3,4)5)26-28(6,7)8/h18,20H,1,10-16H2,2-9H3 |
| InChIKey | FVZNYVMHHIPYSV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.80 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|