C14H32O5Si3 — CID 118855687
[2-hydroxy-3-[methyl-bis(trimethylsilyloxy)silyl]propyl] 2-methylprop-2-enoate (PubChem CID 118855687) has the molecular formula C14H32O5Si3 and a molecular weight of 364.66 g/mol. Its IUPAC name is [2-hydroxy-3-[methyl-bis(trimethylsilyloxy)silyl]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-[methyl-bis(trimethylsilyloxy)silyl]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 118855687 |
| Molecular Formula | C14H32O5Si3 |
| Molecular Weight | 364.66 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | [2-hydroxy-3-[methyl-bis(trimethylsilyloxy)silyl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)C[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H32O5Si3/c1-12(2)14(16)17-10-13(15)11-22(9,18-20(3,4)5)19-21(6,7)8/h13,15H,1,10-11H2,2-9H3 |
| InChIKey | OUSYFXDSWHYKBV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.66 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|