C17H38O6Si3 — CID 87222684
[2-hydroxy-3-[1-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl] 2-methylprop-2-enoate (PubChem CID 87222684) has the molecular formula C17H38O6Si3 and a molecular weight of 422.74 g/mol. Its IUPAC name is [2-hydroxy-3-[1-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-[1-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87222684 |
| Molecular Formula | C17H38O6Si3 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | [2-hydroxy-3-[1-[methyl-bis(trimethylsilyloxy)silyl]propoxy]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(CC)[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H38O6Si3/c1-11-16(20-12-15(18)13-21-17(19)14(2)3)26(10,22-24(4,5)6)23-25(7,8)9/h15-16,18H,2,11-13H2,1,3-10H3 |
| InChIKey | RYSHRLRCQHIDMW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|