C14H25NO5 — CID 139382686
[3-[2-(butan-2-ylamino)propanoyloxy]-2-hydroxypropyl] 2-methylprop-2-enoate (PubChem CID 139382686) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is [3-[2-(butan-2-ylamino)propanoyloxy]-2-hydroxypropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[2-(butan-2-ylamino)propanoyloxy]-2-hydroxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139382686 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | [3-[2-(butan-2-ylamino)propanoyloxy]-2-hydroxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)C(C)NC(C)CC |
| InChI | InChI=1S/C14H25NO5/c1-6-10(4)15-11(5)14(18)20-8-12(16)7-19-13(17)9(2)3/h10-12,15-16H,2,6-8H2,1,3-5H3 |
| InChIKey | AIIKNOKVSQPQKJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|