C13H28O5Si2 — CID 58512799
[2-hydroxy-4-(methoxy-methyl-trimethylsilyloxysilyl)butyl] 2-methylprop-2-enoate (PubChem CID 58512799) has the molecular formula C13H28O5Si2 and a molecular weight of 320.53 g/mol. Its IUPAC name is [2-hydroxy-4-(methoxy-methyl-trimethylsilyloxysilyl)butyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-4-(methoxy-methyl-trimethylsilyloxysilyl)butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58512799 |
| Molecular Formula | C13H28O5Si2 |
| Molecular Weight | 320.53 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | [2-hydroxy-4-(methoxy-methyl-trimethylsilyloxysilyl)butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CC[Si](C)(OC)O[Si](C)(C)C |
| InChI | InChI=1S/C13H28O5Si2/c1-11(2)13(15)17-10-12(14)8-9-20(7,16-3)18-19(4,5)6/h12,14H,1,8-10H2,2-7H3 |
| InChIKey | LSYVRQPQSOVJSV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.53 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|