C15H31NO6Si2 — CID 58983328
2-[3-(methoxy-methyl-trimethylsilyloxysilyl)propoxycarbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 58983328) has the molecular formula C15H31NO6Si2 and a molecular weight of 377.59 g/mol. Its IUPAC name is 2-[3-(methoxy-methyl-trimethylsilyloxysilyl)propoxycarbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-(methoxy-methyl-trimethylsilyloxysilyl)propoxycarbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58983328 |
| Molecular Formula | C15H31NO6Si2 |
| Molecular Weight | 377.59 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-[3-(methoxy-methyl-trimethylsilyloxysilyl)propoxycarbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCC[Si](C)(OC)O[Si](C)(C)C |
| InChI | InChI=1S/C15H31NO6Si2/c1-13(2)14(17)20-11-9-16-15(18)21-10-8-12-24(7,19-3)22-23(4,5)6/h1,8-12H2,2-7H3,(H,16,18) |
| InChIKey | BMAJJABMCBYMAA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.59 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|