C14H27NO6Si — CID 158336407
3-[dimethoxy(methyl)silyl]propyl N-[2-(3-methyl-2-oxobut-3-enoxy)ethyl]carbamate (PubChem CID 158336407) has the molecular formula C14H27NO6Si and a molecular weight of 333.46 g/mol. Its IUPAC name is 3-[dimethoxy(methyl)silyl]propyl N-[2-(3-methyl-2-oxobut-3-enoxy)ethyl]carbamate.
| Compound Name | 3-[dimethoxy(methyl)silyl]propyl N-[2-(3-methyl-2-oxobut-3-enoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 158336407 |
| Molecular Formula | C14H27NO6Si |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 3-[dimethoxy(methyl)silyl]propyl N-[2-(3-methyl-2-oxobut-3-enoxy)ethyl]carbamate |
| SMILES | C=C(C)C(=O)COCCNC(=O)OCCC[Si](C)(OC)OC |
| InChI | InChI=1S/C14H27NO6Si/c1-12(2)13(16)11-20-9-7-15-14(17)21-8-6-10-22(5,18-3)19-4/h1,6-11H2,2-5H3,(H,15,17) |
| InChIKey | QSFLFFMIWVJTES-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|