C57H157NO27Si24 — CID 59838932
CID 59838932 (PubChem CID 59838932) has the molecular formula C57H157NO27Si24 and a molecular weight of 1962.93 g/mol.
| Compound Name | CID 59838932 |
|---|---|
| PubChem CID | 59838932 |
| Molecular Formula | C57H157NO27Si24 |
| Molecular Weight | 1962.93 g/mol |
| Exact Mass | 1959.54 |
| IUPAC Name | — |
| SMILES | C=C(C)C(=O)OCCNC(=O)OCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si]C |
| InChI | InChI=1S/C57H157NO27Si24/c1-55(2)56(59)61-53-51-58-57(60)62-52-50-54-87(4,5)64-89(8,9)66-91(12,13)68-93(16,17)70-95(20,21)72-97(24,25)74-99(28,29)76-101(32,33)78-103(36,37)80-105(40,41)82-107(44,45)84-109(48,49)85-108(46,47)83-106(42,43)81-104(38,39)79-102(34,35)77-100(30,31)75-98(26,27)73-96(22,23)71-94(18,19)69-92(14,15)67-90(10,11)65-88(6,7)63-86-3/h1,50-54H2,2-49H3,(H,58,60) |
| InChIKey | ALEARGSREXPBSL-UHFFFAOYSA-N |
| XLogP | 17.92 |
| TPSA | 276.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 27 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 109 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1962.93 |
| LogP ≤ 5 | 17.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 27 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|