C24H52O8Si5 — CID 165004417
3-[[[[[dimethyl(3-propanoyloxypropyl)silyl]oxy-dimethylsilyl]oxy-ethenyl-methylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate (PubChem CID 165004417) has the molecular formula C24H52O8Si5 and a molecular weight of 609.10 g/mol. Its IUPAC name is 3-[[[[[dimethyl(3-propanoyloxypropyl)silyl]oxy-dimethylsilyl]oxy-ethenyl-methylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[[[[[dimethyl(3-propanoyloxypropyl)silyl]oxy-dimethylsilyl]oxy-ethenyl-methylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 165004417 |
| Molecular Formula | C24H52O8Si5 |
| Molecular Weight | 609.10 g/mol |
| Exact Mass | 608.25 |
| IUPAC Name | 3-[[[[[dimethyl(3-propanoyloxypropyl)silyl]oxy-dimethylsilyl]oxy-ethenyl-methylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C[Si](C)(O[Si](C)(C)O[Si](C)(C)CCCOC(=O)CC)O[Si](C)(C)O[Si](C)(C)CCCOC(=O)C(=C)C |
| InChI | InChI=1S/C24H52O8Si5/c1-14-23(25)27-18-16-20-33(5,6)29-35(9,10)31-37(13,15-2)32-36(11,12)30-34(7,8)21-17-19-28-24(26)22(3)4/h15H,2-3,14,16-21H2,1,4-13H3 |
| InChIKey | ISZXNKNTLPVEOJ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.10 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|