C18H34O5Si2 — CID 59281013
prop-1-en-2-yl 4-[[dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxy-dimethylsilyl]butanoate (PubChem CID 59281013) has the molecular formula C18H34O5Si2 and a molecular weight of 386.64 g/mol. Its IUPAC name is prop-1-en-2-yl 4-[[dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxy-dimethylsilyl]butanoate.
| Compound Name | prop-1-en-2-yl 4-[[dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxy-dimethylsilyl]butanoate |
|---|---|
| PubChem CID | 59281013 |
| Molecular Formula | C18H34O5Si2 |
| Molecular Weight | 386.64 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | prop-1-en-2-yl 4-[[dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxy-dimethylsilyl]butanoate |
| SMILES | C=C(C)OC(=O)CCC[Si](C)(C)O[Si](C)(C)CCCOC(=O)C(=C)C |
| InChI | InChI=1S/C18H34O5Si2/c1-15(2)18(20)21-12-10-14-25(7,8)23-24(5,6)13-9-11-17(19)22-16(3)4/h1,3,9-14H2,2,4-8H3 |
| InChIKey | ISJMETCMIBFKOM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|