C20H40O6Si3 — CID 158834498
carbon dioxide;3-[[[dimethyl(4-methylpent-4-enyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate (PubChem CID 158834498) has the molecular formula C20H40O6Si3 and a molecular weight of 460.79 g/mol. Its IUPAC name is carbon dioxide;3-[[[dimethyl(4-methylpent-4-enyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate.
| Compound Name | carbon dioxide;3-[[[dimethyl(4-methylpent-4-enyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158834498 |
| Molecular Formula | C20H40O6Si3 |
| Molecular Weight | 460.79 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | carbon dioxide;3-[[[dimethyl(4-methylpent-4-enyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)CCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCOC(=O)C(=C)C.O=C=O |
| InChI | InChI=1S/C19H40O4Si3.CO2/c1-17(2)13-11-15-24(5,6)22-26(9,10)23-25(7,8)16-12-14-21-19(20)18(3)4;2-1-3/h1,3,11-16H2,2,4-10H3; |
| InChIKey | IXLPJZYMVXYIRR-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.79 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|