C13H28N2O6S2Si — CID 174110357
2-[2-(methylcarbamoyloxy)ethyldisulfanyl]ethyl N-[3-[dimethoxy(methyl)silyl]propyl]carbamate (PubChem CID 174110357) has the molecular formula C13H28N2O6S2Si and a molecular weight of 400.60 g/mol. Its IUPAC name is 2-[2-(methylcarbamoyloxy)ethyldisulfanyl]ethyl N-[3-[dimethoxy(methyl)silyl]propyl]carbamate.
| Compound Name | 2-[2-(methylcarbamoyloxy)ethyldisulfanyl]ethyl N-[3-[dimethoxy(methyl)silyl]propyl]carbamate |
|---|---|
| PubChem CID | 174110357 |
| Molecular Formula | C13H28N2O6S2Si |
| Molecular Weight | 400.60 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 2-[2-(methylcarbamoyloxy)ethyldisulfanyl]ethyl N-[3-[dimethoxy(methyl)silyl]propyl]carbamate |
| SMILES | CNC(=O)OCCSSCCOC(=O)NCCC[Si](C)(OC)OC |
| InChI | InChI=1S/C13H28N2O6S2Si/c1-14-12(16)20-7-9-22-23-10-8-21-13(17)15-6-5-11-24(4,18-2)19-3/h5-11H2,1-4H3,(H,14,16)(H,15,17) |
| InChIKey | ZHAFRAFHSSOWRB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.60 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|