C7H13NO3S2 — CID 122630071
2-(3-oxopropyldisulfanyl)ethyl N-methylcarbamate (PubChem CID 122630071) has the molecular formula C7H13NO3S2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(3-oxopropyldisulfanyl)ethyl N-methylcarbamate.
| Compound Name | 2-(3-oxopropyldisulfanyl)ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 122630071 |
| Molecular Formula | C7H13NO3S2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.03 |
| IUPAC Name | 2-(3-oxopropyldisulfanyl)ethyl N-methylcarbamate |
| SMILES | CNC(=O)OCCSSCCC=O |
| InChI | InChI=1S/C7H13NO3S2/c1-8-7(10)11-4-6-13-12-5-2-3-9/h3H,2,4-6H2,1H3,(H,8,10) |
| InChIKey | NXUVVDJDEKIJTL-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|