C12H24N6O10S2 — CID 102048160
2-[2-[(2-aminooxyethoxycarbonylamino)carbamoyloxy]ethyldisulfanyl]ethyl N-(2-aminooxyethoxycarbonylamino)carbamate (PubChem CID 102048160) has the molecular formula C12H24N6O10S2 and a molecular weight of 476.49 g/mol. Its IUPAC name is 2-[2-[(2-aminooxyethoxycarbonylamino)carbamoyloxy]ethyldisulfanyl]ethyl N-(2-aminooxyethoxycarbonylamino)carbamate.
| Compound Name | 2-[2-[(2-aminooxyethoxycarbonylamino)carbamoyloxy]ethyldisulfanyl]ethyl N-(2-aminooxyethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 102048160 |
| Molecular Formula | C12H24N6O10S2 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 2-[2-[(2-aminooxyethoxycarbonylamino)carbamoyloxy]ethyldisulfanyl]ethyl N-(2-aminooxyethoxycarbonylamino)carbamate |
| SMILES | NOCCOC(=O)NNC(=O)OCCSSCCOC(=O)NNC(=O)OCCON |
| InChI | InChI=1S/C12H24N6O10S2/c13-27-3-1-23-9(19)15-17-11(21)25-5-7-29-30-8-6-26-12(22)18-16-10(20)24-2-4-28-14/h1-8,13-14H2,(H,15,19)(H,16,20)(H,17,21)(H,18,22) |
| InChIKey | VKRZFVOWBYTZTP-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 223.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|