C11H19NO5S2 — CID 139453995
2-[2-(2-methoxyethyldisulfanyl)ethoxycarbonylamino]ethyl prop-2-enoate (PubChem CID 139453995) has the molecular formula C11H19NO5S2 and a molecular weight of 309.41 g/mol. Its IUPAC name is 2-[2-(2-methoxyethyldisulfanyl)ethoxycarbonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[2-(2-methoxyethyldisulfanyl)ethoxycarbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 139453995 |
| Molecular Formula | C11H19NO5S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-[2-(2-methoxyethyldisulfanyl)ethoxycarbonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OCCSSCCOC |
| InChI | InChI=1S/C11H19NO5S2/c1-3-10(13)16-5-4-12-11(14)17-7-9-19-18-8-6-15-2/h3H,1,4-9H2,2H3,(H,12,14) |
| InChIKey | FNPCZQUBRGPJBV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|