C18H29NO8 — CID 155382195
1-O-methyl 5-O-[2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl] 2,2,3,3-tetramethylpentanedioate (PubChem CID 155382195) has the molecular formula C18H29NO8 and a molecular weight of 387.43 g/mol. Its IUPAC name is 1-O-methyl 5-O-[2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl] 2,2,3,3-tetramethylpentanedioate.
| Compound Name | 1-O-methyl 5-O-[2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl] 2,2,3,3-tetramethylpentanedioate |
|---|---|
| PubChem CID | 155382195 |
| Molecular Formula | C18H29NO8 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 1-O-methyl 5-O-[2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethyl] 2,2,3,3-tetramethylpentanedioate |
| SMILES | C=CC(=O)OCCNC(=O)OCCOC(=O)CC(C)(C)C(C)(C)C(=O)OC |
| InChI | InChI=1S/C18H29NO8/c1-7-13(20)25-9-8-19-16(23)27-11-10-26-14(21)12-17(2,3)18(4,5)15(22)24-6/h7H,1,8-12H2,2-6H3,(H,19,23) |
| InChIKey | YYUBLULJEKZFQK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|