C26H36N2O10 — CID 118331547
2-[2-[4-tert-butyl-2-[2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethoxy]phenoxy]ethoxycarbonylamino]ethyl prop-2-enoate (PubChem CID 118331547) has the molecular formula C26H36N2O10 and a molecular weight of 536.58 g/mol. Its IUPAC name is 2-[2-[4-tert-butyl-2-[2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethoxy]phenoxy]ethoxycarbonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[2-[4-tert-butyl-2-[2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethoxy]phenoxy]ethoxycarbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 118331547 |
| Molecular Formula | C26H36N2O10 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | 2-[2-[4-tert-butyl-2-[2-(2-prop-2-enoyloxyethylcarbamoyloxy)ethoxy]phenoxy]ethoxycarbonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OCCOc1ccc(C(C)(C)C)cc1OCCOC(=O)NCCOC(=O)C=C |
| InChI | InChI=1S/C26H36N2O10/c1-6-22(29)35-12-10-27-24(31)37-16-14-33-20-9-8-19(26(3,4)5)18-21(20)34-15-17-38-25(32)28-11-13-36-23(30)7-2/h6-9,18H,1-2,10-17H2,3-5H3,(H,27,31)(H,28,32) |
| InChIKey | UXBNXLKXZFOQML-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|