C23H33NO5 — CID 156746841
2-[2-[4-[(Z)-2,4,5-trimethylhex-3-en-3-yl]phenoxy]ethoxycarbonylamino]ethyl prop-2-enoate (PubChem CID 156746841) has the molecular formula C23H33NO5 and a molecular weight of 403.52 g/mol. Its IUPAC name is 2-[2-[4-[(Z)-2,4,5-trimethylhex-3-en-3-yl]phenoxy]ethoxycarbonylamino]ethyl prop-2-enoate.
| Compound Name | 2-[2-[4-[(Z)-2,4,5-trimethylhex-3-en-3-yl]phenoxy]ethoxycarbonylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 156746841 |
| Molecular Formula | C23H33NO5 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 2-[2-[4-[(Z)-2,4,5-trimethylhex-3-en-3-yl]phenoxy]ethoxycarbonylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNC(=O)OCCOc1ccc(/C(=C(/C)C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C23H33NO5/c1-7-21(25)28-13-12-24-23(26)29-15-14-27-20-10-8-19(9-11-20)22(17(4)5)18(6)16(2)3/h7-11,16-17H,1,12-15H2,2-6H3,(H,24,26)/b22-18- |
| InChIKey | BBVSFPUEIQGGNC-PYCFMQQDSA-N |
| XLogP | 4.61 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|