C32H48N2O10 — CID 118331575
5-[2-[4-tert-butyl-2-[2-(5-prop-2-enoyloxypentylcarbamoyloxy)ethoxy]phenoxy]ethoxycarbonylamino]pentyl prop-2-enoate (PubChem CID 118331575) has the molecular formula C32H48N2O10 and a molecular weight of 620.74 g/mol. Its IUPAC name is 5-[2-[4-tert-butyl-2-[2-(5-prop-2-enoyloxypentylcarbamoyloxy)ethoxy]phenoxy]ethoxycarbonylamino]pentyl prop-2-enoate.
| Compound Name | 5-[2-[4-tert-butyl-2-[2-(5-prop-2-enoyloxypentylcarbamoyloxy)ethoxy]phenoxy]ethoxycarbonylamino]pentyl prop-2-enoate |
|---|---|
| PubChem CID | 118331575 |
| Molecular Formula | C32H48N2O10 |
| Molecular Weight | 620.74 g/mol |
| Exact Mass | 620.33 |
| IUPAC Name | 5-[2-[4-tert-butyl-2-[2-(5-prop-2-enoyloxypentylcarbamoyloxy)ethoxy]phenoxy]ethoxycarbonylamino]pentyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCNC(=O)OCCOc1ccc(C(C)(C)C)cc1OCCOC(=O)NCCCCCOC(=O)C=C |
| InChI | InChI=1S/C32H48N2O10/c1-6-28(35)41-18-12-8-10-16-33-30(37)43-22-20-39-26-15-14-25(32(3,4)5)24-27(26)40-21-23-44-31(38)34-17-11-9-13-19-42-29(36)7-2/h6-7,14-15,24H,1-2,8-13,16-23H2,3-5H3,(H,33,37)(H,34,38) |
| InChIKey | YSOJPKCMFVJTPB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.74 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|