C26H36N2O8 — CID 122597569
4-[2-[3-[2-(2-prop-2-enoyloxyethoxycarbonylamino)propan-2-yl]phenyl]propan-2-ylcarbamoyloxy]butyl prop-2-enoate (PubChem CID 122597569) has the molecular formula C26H36N2O8 and a molecular weight of 504.58 g/mol. Its IUPAC name is 4-[2-[3-[2-(2-prop-2-enoyloxyethoxycarbonylamino)propan-2-yl]phenyl]propan-2-ylcarbamoyloxy]butyl prop-2-enoate.
| Compound Name | 4-[2-[3-[2-(2-prop-2-enoyloxyethoxycarbonylamino)propan-2-yl]phenyl]propan-2-ylcarbamoyloxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 122597569 |
| Molecular Formula | C26H36N2O8 |
| Molecular Weight | 504.58 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 4-[2-[3-[2-(2-prop-2-enoyloxyethoxycarbonylamino)propan-2-yl]phenyl]propan-2-ylcarbamoyloxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOC(=O)NC(C)(C)c1cccc(C(C)(C)NC(=O)OCCOC(=O)C=C)c1 |
| InChI | InChI=1S/C26H36N2O8/c1-7-21(29)33-14-9-10-15-35-23(31)27-25(3,4)19-12-11-13-20(18-19)26(5,6)28-24(32)36-17-16-34-22(30)8-2/h7-8,11-13,18H,1-2,9-10,14-17H2,3-6H3,(H,27,31)(H,28,32) |
| InChIKey | PHSUARXLDYBZMB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.58 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|