C28H40N2O8 — CID 122597571
2-[2-[3-[2-(1-prop-2-enoyloxybutan-2-yloxycarbonylamino)propan-2-yl]phenyl]propan-2-ylcarbamoyloxy]butyl prop-2-enoate (PubChem CID 122597571) has the molecular formula C28H40N2O8 and a molecular weight of 532.63 g/mol. Its IUPAC name is 2-[2-[3-[2-(1-prop-2-enoyloxybutan-2-yloxycarbonylamino)propan-2-yl]phenyl]propan-2-ylcarbamoyloxy]butyl prop-2-enoate.
| Compound Name | 2-[2-[3-[2-(1-prop-2-enoyloxybutan-2-yloxycarbonylamino)propan-2-yl]phenyl]propan-2-ylcarbamoyloxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 122597571 |
| Molecular Formula | C28H40N2O8 |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.28 |
| IUPAC Name | 2-[2-[3-[2-(1-prop-2-enoyloxybutan-2-yloxycarbonylamino)propan-2-yl]phenyl]propan-2-ylcarbamoyloxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(CC)OC(=O)NC(C)(C)c1cccc(C(C)(C)NC(=O)OC(CC)COC(=O)C=C)c1 |
| InChI | InChI=1S/C28H40N2O8/c1-9-21(17-35-23(31)11-3)37-25(33)29-27(5,6)19-14-13-15-20(16-19)28(7,8)30-26(34)38-22(10-2)18-36-24(32)12-4/h11-16,21-22H,3-4,9-10,17-18H2,1-2,5-8H3,(H,29,33)(H,30,34) |
| InChIKey | NFPWCLOONGBHFY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|