C22H27NO6 — CID 15734519
[3-prop-2-enoyloxy-2-[2-(3-prop-1-en-2-ylphenyl)propan-2-ylcarbamoyloxy]propyl] prop-2-enoate (PubChem CID 15734519) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is [3-prop-2-enoyloxy-2-[2-(3-prop-1-en-2-ylphenyl)propan-2-ylcarbamoyloxy]propyl] prop-2-enoate.
| Compound Name | [3-prop-2-enoyloxy-2-[2-(3-prop-1-en-2-ylphenyl)propan-2-ylcarbamoyloxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 15734519 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | [3-prop-2-enoyloxy-2-[2-(3-prop-1-en-2-ylphenyl)propan-2-ylcarbamoyloxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(COC(=O)C=C)OC(=O)NC(C)(C)c1cccc(C(=C)C)c1 |
| InChI | InChI=1S/C22H27NO6/c1-7-19(24)27-13-18(14-28-20(25)8-2)29-21(26)23-22(5,6)17-11-9-10-16(12-17)15(3)4/h7-12,18H,1-3,13-14H2,4-6H3,(H,23,26) |
| InChIKey | XKOPKFHXDAFBBC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|