C32H44N2O4 — CID 19917583
6-[2-(4-prop-1-en-2-ylphenyl)propan-2-ylcarbamoyloxy]hexyl N-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]carbamate (PubChem CID 19917583) has the molecular formula C32H44N2O4 and a molecular weight of 520.71 g/mol. Its IUPAC name is 6-[2-(4-prop-1-en-2-ylphenyl)propan-2-ylcarbamoyloxy]hexyl N-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]carbamate.
| Compound Name | 6-[2-(4-prop-1-en-2-ylphenyl)propan-2-ylcarbamoyloxy]hexyl N-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 19917583 |
| Molecular Formula | C32H44N2O4 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | 6-[2-(4-prop-1-en-2-ylphenyl)propan-2-ylcarbamoyloxy]hexyl N-[2-(3-prop-1-en-2-ylphenyl)propan-2-yl]carbamate |
| SMILES | C=C(C)c1ccc(C(C)(C)NC(=O)OCCCCCCOC(=O)NC(C)(C)c2cccc(C(=C)C)c2)cc1 |
| InChI | InChI=1S/C32H44N2O4/c1-23(2)25-16-18-27(19-17-25)31(5,6)33-29(35)37-20-11-9-10-12-21-38-30(36)34-32(7,8)28-15-13-14-26(22-28)24(3)4/h13-19,22H,1,3,9-12,20-21H2,2,4-8H3,(H,33,35)(H,34,36) |
| InChIKey | WPSGZYTUEKGEAA-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|