C30H44N2O8 — CID 122597647
2-[2-[3-[2-[1-(2-methylprop-2-enoyloxy)butan-2-yloxycarbonylamino]propan-2-yl]phenyl]propan-2-ylcarbamoyloxy]butyl 2-methylprop-2-enoate (PubChem CID 122597647) has the molecular formula C30H44N2O8 and a molecular weight of 560.69 g/mol. Its IUPAC name is 2-[2-[3-[2-[1-(2-methylprop-2-enoyloxy)butan-2-yloxycarbonylamino]propan-2-yl]phenyl]propan-2-ylcarbamoyloxy]butyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[3-[2-[1-(2-methylprop-2-enoyloxy)butan-2-yloxycarbonylamino]propan-2-yl]phenyl]propan-2-ylcarbamoyloxy]butyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 122597647 |
| Molecular Formula | C30H44N2O8 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.31 |
| IUPAC Name | 2-[2-[3-[2-[1-(2-methylprop-2-enoyloxy)butan-2-yloxycarbonylamino]propan-2-yl]phenyl]propan-2-ylcarbamoyloxy]butyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CC)OC(=O)NC(C)(C)c1cccc(C(C)(C)NC(=O)OC(CC)COC(=O)C(=C)C)c1 |
| InChI | InChI=1S/C30H44N2O8/c1-11-23(17-37-25(33)19(3)4)39-27(35)31-29(7,8)21-14-13-15-22(16-21)30(9,10)32-28(36)40-24(12-2)18-38-26(34)20(5)6/h13-16,23-24H,3,5,11-12,17-18H2,1-2,4,6-10H3,(H,31,35)(H,32,36) |
| InChIKey | AQKFEESFWOSOQS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|