C30H41N3O7 — CID 54434842
4-(prop-2-enoylamino)butyl 3-[3,4-bis[4-(prop-2-enoylamino)butoxy]phenyl]prop-2-enoate (PubChem CID 54434842) has the molecular formula C30H41N3O7 and a molecular weight of 555.67 g/mol. Its IUPAC name is 4-(prop-2-enoylamino)butyl 3-[3,4-bis[4-(prop-2-enoylamino)butoxy]phenyl]prop-2-enoate.
| Compound Name | 4-(prop-2-enoylamino)butyl 3-[3,4-bis[4-(prop-2-enoylamino)butoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 54434842 |
| Molecular Formula | C30H41N3O7 |
| Molecular Weight | 555.67 g/mol |
| Exact Mass | 555.29 |
| IUPAC Name | 4-(prop-2-enoylamino)butyl 3-[3,4-bis[4-(prop-2-enoylamino)butoxy]phenyl]prop-2-enoate |
| SMILES | C=CC(=O)NCCCCOC(=O)C=Cc1ccc(OCCCCNC(=O)C=C)c(OCCCCNC(=O)C=C)c1 |
| InChI | InChI=1S/C30H41N3O7/c1-4-27(34)31-17-7-10-20-38-25-15-13-24(23-26(25)39-21-11-8-18-32-28(35)5-2)14-16-30(37)40-22-12-9-19-33-29(36)6-3/h4-6,13-16,23H,1-3,7-12,17-22H2,(H,31,34)(H,32,35)(H,33,36) |
| InChIKey | WJZXEJJKPXBPFB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.67 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|