C40H44N2O10 — CID 58444525
4-[2-methoxy-4-[(E)-3-[4-[[(E)-3-[3-methoxy-4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]amino]anilino]-3-oxoprop-1-enyl]phenoxy]butyl prop-2-enoate (PubChem CID 58444525) has the molecular formula C40H44N2O10 and a molecular weight of 712.80 g/mol. Its IUPAC name is 4-[2-methoxy-4-[(E)-3-[4-[[(E)-3-[3-methoxy-4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]amino]anilino]-3-oxoprop-1-enyl]phenoxy]butyl prop-2-enoate.
| Compound Name | 4-[2-methoxy-4-[(E)-3-[4-[[(E)-3-[3-methoxy-4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]amino]anilino]-3-oxoprop-1-enyl]phenoxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 58444525 |
| Molecular Formula | C40H44N2O10 |
| Molecular Weight | 712.80 g/mol |
| Exact Mass | 712.30 |
| IUPAC Name | 4-[2-methoxy-4-[(E)-3-[4-[[(E)-3-[3-methoxy-4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl]amino]anilino]-3-oxoprop-1-enyl]phenoxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(/C=C/C(=O)Nc2ccc(NC(=O)/C=C/c3ccc(OCCCCOC(=O)C=C)c(OC)c3)cc2)cc1OC |
| InChI | InChI=1S/C40H44N2O10/c1-5-39(45)51-25-9-7-23-49-33-19-11-29(27-35(33)47-3)13-21-37(43)41-31-15-17-32(18-16-31)42-38(44)22-14-30-12-20-34(36(28-30)48-4)50-24-8-10-26-52-40(46)6-2/h5-6,11-22,27-28H,1-2,7-10,23-26H2,3-4H3,(H,41,43)(H,42,44)/b21-13+,22-14+ |
| InChIKey | HSFNZMBAWTVQAM-JFMUQQRKSA-N |
| XLogP | 6.78 |
| TPSA | 147.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.80 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|